C10H20N2O2S2 — CID 62574345
1,1-dioxo-N-(2-thiomorpholin-4-ylethyl)thiolan-3-amine (PubChem CID 62574345) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 1,1-dioxo-N-(2-thiomorpholin-4-ylethyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-(2-thiomorpholin-4-ylethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 62574345 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1,1-dioxo-N-(2-thiomorpholin-4-ylethyl)thiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCCN2CCSCC2)C1 |
| InChI | InChI=1S/C10H20N2O2S2/c13-16(14)8-1-10(9-16)11-2-3-12-4-6-15-7-5-12/h10-11H,1-9H2 |
| InChIKey | GPAAEIWXVYOGJC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |