C12H24N2O3S — CID 62560596
N-[2-(2-ethylmorpholin-4-yl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 62560596) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is N-[2-(2-ethylmorpholin-4-yl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[2-(2-ethylmorpholin-4-yl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 62560596 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-[2-(2-ethylmorpholin-4-yl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCC1CN(CCNC2CCS(=O)(=O)C2)CCO1 |
| InChI | InChI=1S/C12H24N2O3S/c1-2-12-9-14(6-7-17-12)5-4-13-11-3-8-18(15,16)10-11/h11-13H,2-10H2,1H3 |
| InChIKey | WMBPMRSYVCHGEV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |