C11H22N2O3S — CID 79165323
N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 79165323) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 79165323 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCN1CCOC(CNC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-2-13-4-5-16-11(8-13)7-12-10-3-6-17(14,15)9-10/h10-12H,2-9H2,1H3 |
| InChIKey | ZRMUCITXMBIQQO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |