C10H15N3O3S — CID 62849985
2-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridazin-3-one (PubChem CID 62849985) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridazin-3-one.
| Compound Name | 2-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 62849985 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridazin-3-one |
| SMILES | O=c1cccnn1CCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15N3O3S/c14-10-2-1-4-12-13(10)6-5-11-9-3-7-17(15,16)8-9/h1-2,4,9,11H,3,5-8H2 |
| InChIKey | IMFRUCZRVVBOGU-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |