C14H26N6O3 — CID 154913117
2-[1-ethyl-5-[(4-ethylpiperazin-1-yl)methyl]-1,2,4-triazol-3-yl]acetamide;formic acid (PubChem CID 154913117) has the molecular formula C14H26N6O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[1-ethyl-5-[(4-ethylpiperazin-1-yl)methyl]-1,2,4-triazol-3-yl]acetamide;formic acid.
| Compound Name | 2-[1-ethyl-5-[(4-ethylpiperazin-1-yl)methyl]-1,2,4-triazol-3-yl]acetamide;formic acid |
|---|---|
| PubChem CID | 154913117 |
| Molecular Formula | C14H26N6O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-[1-ethyl-5-[(4-ethylpiperazin-1-yl)methyl]-1,2,4-triazol-3-yl]acetamide;formic acid |
| SMILES | CCN1CCN(Cc2nc(CC(N)=O)nn2CC)CC1.O=CO |
| InChI | InChI=1S/C13H24N6O.CH2O2/c1-3-17-5-7-18(8-6-17)10-13-15-12(9-11(14)20)16-19(13)4-2;2-1-3/h3-10H2,1-2H3,(H2,14,20);1H,(H,2,3) |
| InChIKey | PJJFVIBPBRFDRV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|