C19H32N2O5 — CID 154913932
5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one;formic acid (PubChem CID 154913932) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one;formic acid.
| Compound Name | 5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one;formic acid |
|---|---|
| PubChem CID | 154913932 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one;formic acid |
| SMILES | O=C1CCC(N2C[C@H]3C[C@H](O)[C@H](O)C[C@H]3C2)CCN1CC1CC1.O=CO |
| InChI | InChI=1S/C18H30N2O3.CH2O2/c21-16-7-13-10-20(11-14(13)8-17(16)22)15-3-4-18(23)19(6-5-15)9-12-1-2-12;2-1-3/h12-17,21-22H,1-11H2;1H,(H,2,3)/t13-,14+,15?,16+,17-; |
| InChIKey | STHWPDVOOJBDHU-CIKIFYFUSA-N |
| XLogP | 0.54 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|