C18H30N2O3 — CID 134703034
5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one (PubChem CID 134703034) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one.
| Compound Name | 5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one |
|---|---|
| PubChem CID | 134703034 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 5-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-(cyclopropylmethyl)azepan-2-one |
| SMILES | O=C1CCC(N2C[C@H]3C[C@H](O)[C@H](O)C[C@H]3C2)CCN1CC1CC1 |
| InChI | InChI=1S/C18H30N2O3/c21-16-7-13-10-20(11-14(13)8-17(16)22)15-3-4-18(23)19(6-5-15)9-12-1-2-12/h12-17,21-22H,1-11H2/t13-,14+,15?,16+,17- |
| InChIKey | ZLGIGWKNBOEKPW-GIIYMVLFSA-N |
| XLogP | 0.84 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |