C17H30N2O3 — CID 138807904
5-[[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-propan-2-ylpiperidin-2-one (PubChem CID 138807904) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 5-[[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-propan-2-ylpiperidin-2-one.
| Compound Name | 5-[[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-propan-2-ylpiperidin-2-one |
|---|---|
| PubChem CID | 138807904 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 5-[[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-propan-2-ylpiperidin-2-one |
| SMILES | CC(C)N1CC(CN2C[C@H]3C[C@H](O)[C@H](O)C[C@H]3C2)CCC1=O |
| InChI | InChI=1S/C17H30N2O3/c1-11(2)19-8-12(3-4-17(19)22)7-18-9-13-5-15(20)16(21)6-14(13)10-18/h11-16,20-21H,3-10H2,1-2H3/t12?,13-,14+,15+,16- |
| InChIKey | LKSVTAAGGCKVNY-ANMDTKTJSA-N |
| XLogP | 0.70 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |