C20H28N4O4 — CID 154914039
(3-cyclopropyl-1,2-oxazol-5-yl)-[4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 154914039) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is (3-cyclopropyl-1,2-oxazol-5-yl)-[4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | (3-cyclopropyl-1,2-oxazol-5-yl)-[4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154914039 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (3-cyclopropyl-1,2-oxazol-5-yl)-[4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | O=C(c1cc(C2CC2)no1)N1CCCN(CCCn2cccc2)CC1.O=CO |
| InChI | InChI=1S/C19H26N4O2.CH2O2/c24-19(18-15-17(20-25-18)16-5-6-16)23-12-4-11-22(13-14-23)10-3-9-21-7-1-2-8-21;2-1-3/h1-2,7-8,15-16H,3-6,9-14H2;1H,(H,2,3) |
| InChIKey | AUFLETKOIKYVMM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|