C20H28N6O5 — CID 171321520
(2-cyclopropylpyrimidin-5-yl)-[4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 171321520) has the molecular formula C20H28N6O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (2-cyclopropylpyrimidin-5-yl)-[4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | (2-cyclopropylpyrimidin-5-yl)-[4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 171321520 |
| Molecular Formula | C20H28N6O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (2-cyclopropylpyrimidin-5-yl)-[4-(2-imidazol-1-ylethyl)-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | O=C(c1cnc(C2CC2)nc1)N1CCCN(CCn2ccnc2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C18H24N6O.2CH2O2/c25-18(16-12-20-17(21-13-16)15-2-3-15)24-6-1-5-22(10-11-24)8-9-23-7-4-19-14-23;2*2-1-3/h4,7,12-15H,1-3,5-6,8-11H2;2*1H,(H,2,3) |
| InChIKey | PTENFCDZKHHXPI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|