C15H21N5O3S — CID 154919335
formic acid;thiophen-3-yl-[4-[2-(1,2,4-triazol-4-yl)ethyl]-1,4-diazepan-1-yl]methanone (PubChem CID 154919335) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is formic acid;thiophen-3-yl-[4-[2-(1,2,4-triazol-4-yl)ethyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | formic acid;thiophen-3-yl-[4-[2-(1,2,4-triazol-4-yl)ethyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 154919335 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | formic acid;thiophen-3-yl-[4-[2-(1,2,4-triazol-4-yl)ethyl]-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1ccsc1)N1CCCN(CCn2cnnc2)CC1.O=CO |
| InChI | InChI=1S/C14H19N5OS.CH2O2/c20-14(13-2-9-21-10-13)19-4-1-3-17(7-8-19)5-6-18-11-15-16-12-18;2-1-3/h2,9-12H,1,3-8H2;1H,(H,2,3) |
| InChIKey | BDKWRAVQKKTGER-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|