C16H27N5O3 — CID 154914525
6-[(1,4-dimethylpiperazin-2-yl)methylamino]-N,N-dimethylpyridine-2-carboxamide;formic acid (PubChem CID 154914525) has the molecular formula C16H27N5O3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6-[(1,4-dimethylpiperazin-2-yl)methylamino]-N,N-dimethylpyridine-2-carboxamide;formic acid.
| Compound Name | 6-[(1,4-dimethylpiperazin-2-yl)methylamino]-N,N-dimethylpyridine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 154914525 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 6-[(1,4-dimethylpiperazin-2-yl)methylamino]-N,N-dimethylpyridine-2-carboxamide;formic acid |
| SMILES | CN1CCN(C)C(CNc2cccc(C(=O)N(C)C)n2)C1.O=CO |
| InChI | InChI=1S/C15H25N5O.CH2O2/c1-18(2)15(21)13-6-5-7-14(17-13)16-10-12-11-19(3)8-9-20(12)4;2-1-3/h5-7,12H,8-11H2,1-4H3,(H,16,17);1H,(H,2,3) |
| InChIKey | FEVPSPGEFWUSFC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|