C20H37N3O5 — CID 154915777
formic acid;(2S)-1-methyl-N-[[1-(4-methylpent-3-enyl)piperidin-4-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 154915777) has the molecular formula C20H37N3O5 and a molecular weight of 399.53 g/mol. Its IUPAC name is formic acid;(2S)-1-methyl-N-[[1-(4-methylpent-3-enyl)piperidin-4-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | formic acid;(2S)-1-methyl-N-[[1-(4-methylpent-3-enyl)piperidin-4-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154915777 |
| Molecular Formula | C20H37N3O5 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | formic acid;(2S)-1-methyl-N-[[1-(4-methylpent-3-enyl)piperidin-4-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)=CCCN1CCC(CNC(=O)[C@@H]2CCCN2C)CC1.O=CO.O=CO |
| InChI | InChI=1S/C18H33N3O.2CH2O2/c1-15(2)6-4-11-21-12-8-16(9-13-21)14-19-18(22)17-7-5-10-20(17)3;2*2-1-3/h6,16-17H,4-5,7-14H2,1-3H3,(H,19,22);2*1H,(H,2,3)/t17-;;/m0../s1 |
| InChIKey | KCGYRCNIJYCUKX-RMRYJAPISA-N |
| XLogP | 1.67 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|