C18H27NO6 — CID 154916032
formic acid;(3S,4S)-9-[(3-hydroxyphenyl)methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecane-3,4-diol (PubChem CID 154916032) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is formic acid;(3S,4S)-9-[(3-hydroxyphenyl)methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecane-3,4-diol.
| Compound Name | formic acid;(3S,4S)-9-[(3-hydroxyphenyl)methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecane-3,4-diol |
|---|---|
| PubChem CID | 154916032 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | formic acid;(3S,4S)-9-[(3-hydroxyphenyl)methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecane-3,4-diol |
| SMILES | C[C@]1(O)CC2(CCN(Cc3cccc(O)c3)CC2)OC[C@@H]1O.O=CO |
| InChI | InChI=1S/C17H25NO4.CH2O2/c1-16(21)12-17(22-11-15(16)20)5-7-18(8-6-17)10-13-3-2-4-14(19)9-13;2-1-3/h2-4,9,15,19-21H,5-8,10-12H2,1H3;1H,(H,2,3)/t15-,16-;/m0./s1 |
| InChIKey | VOCXODVPAGAXHK-MOGJOVFKSA-N |
| XLogP | 0.96 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|