C21H29N3O5 — CID 166598531
formic acid;(3S,4R)-9-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecane-3,4-diol (PubChem CID 166598531) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is formic acid;(3S,4R)-9-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecane-3,4-diol.
| Compound Name | formic acid;(3S,4R)-9-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecane-3,4-diol |
|---|---|
| PubChem CID | 166598531 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | formic acid;(3S,4R)-9-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecane-3,4-diol |
| SMILES | O=CO.O[C@@H]1CC2(CCN(Cc3cccc(Cn4cccn4)c3)CC2)OC[C@@H]1O |
| InChI | InChI=1S/C20H27N3O3.CH2O2/c24-18-12-20(26-15-19(18)25)5-9-22(10-6-20)13-16-3-1-4-17(11-16)14-23-8-2-7-21-23;2-1-3/h1-4,7-8,11,18-19,24-25H,5-6,9-10,12-15H2;1H,(H,2,3)/t18-,19+;/m1./s1 |
| InChIKey | UPLVFFZETDFKCD-VOMIJIAVSA-N |
| XLogP | 1.11 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|