C16H22N2O7S — CID 154916313
formic acid;3-[[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]sulfonyl]benzoic acid (PubChem CID 154916313) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is formic acid;3-[[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]sulfonyl]benzoic acid.
| Compound Name | formic acid;3-[[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 154916313 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | formic acid;3-[[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]sulfonyl]benzoic acid |
| SMILES | CN1C[C@H]2COC[C@@H]1CN(S(=O)(=O)c1cccc(C(=O)O)c1)C2.O=CO |
| InChI | InChI=1S/C15H20N2O5S.CH2O2/c1-16-6-11-7-17(8-13(16)10-22-9-11)23(20,21)14-4-2-3-12(5-14)15(18)19;2-1-3/h2-5,11,13H,6-10H2,1H3,(H,18,19);1H,(H,2,3)/t11-,13+;/m1./s1 |
| InChIKey | RZBBNTFQMLCWPS-YLAFAASESA-N |
| XLogP | 0.04 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|