C19H27F2NO5 — CID 154916360
9-[[2-(difluoromethoxy)phenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid (PubChem CID 154916360) has the molecular formula C19H27F2NO5 and a molecular weight of 387.42 g/mol. Its IUPAC name is 9-[[2-(difluoromethoxy)phenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid.
| Compound Name | 9-[[2-(difluoromethoxy)phenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid |
|---|---|
| PubChem CID | 154916360 |
| Molecular Formula | C19H27F2NO5 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 9-[[2-(difluoromethoxy)phenyl]methyl]-4-methyl-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid |
| SMILES | CC1(O)CCOC2(CCN(Cc3ccccc3OC(F)F)CC2)C1.O=CO |
| InChI | InChI=1S/C18H25F2NO3.CH2O2/c1-17(22)8-11-23-18(13-17)6-9-21(10-7-18)12-14-4-2-3-5-15(14)24-16(19)20;2-1-3/h2-5,16,22H,6-13H2,1H3;1H,(H,2,3) |
| InChIKey | MPDYYJLGNLHIRS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|