C24H32N2O5 — CID 171316787
formic acid;4-methyl-9-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecan-4-ol (PubChem CID 171316787) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is formic acid;4-methyl-9-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecan-4-ol.
| Compound Name | formic acid;4-methyl-9-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecan-4-ol |
|---|---|
| PubChem CID | 171316787 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | formic acid;4-methyl-9-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-1-oxa-9-azaspiro[5.5]undecan-4-ol |
| SMILES | CC1(O)CCOC2(CCN(Cc3ccc(OCc4ccccn4)cc3)CC2)C1.O=CO |
| InChI | InChI=1S/C23H30N2O3.CH2O2/c1-22(26)11-15-28-23(18-22)9-13-25(14-10-23)16-19-5-7-21(8-6-19)27-17-20-4-2-3-12-24-20;2-1-3/h2-8,12,26H,9-11,13-18H2,1H3;1H,(H,2,3) |
| InChIKey | JGYSKGIYAIDLKW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|