C15H27Cl2N5O — CID 154916494
1-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-methyl-1H-imidazol-4-yl)ethanone;dihydrochloride (PubChem CID 154916494) has the molecular formula C15H27Cl2N5O and a molecular weight of 364.32 g/mol. Its IUPAC name is 1-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-methyl-1H-imidazol-4-yl)ethanone;dihydrochloride.
| Compound Name | 1-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-methyl-1H-imidazol-4-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 154916494 |
| Molecular Formula | C15H27Cl2N5O |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[3a-[(dimethylamino)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(5-methyl-1H-imidazol-4-yl)ethanone;dihydrochloride |
| SMILES | Cc1[nH]cnc1CC(=O)N1CC2CNCC2(CN(C)C)C1.Cl.Cl |
| InChI | InChI=1S/C15H25N5O.2ClH/c1-11-13(18-10-17-11)4-14(21)20-6-12-5-16-7-15(12,9-20)8-19(2)3;;/h10,12,16H,4-9H2,1-3H3,(H,17,18);2*1H |
| InChIKey | PJMRWTOHSARJOT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |