C20H27N3O5 — CID 154916535
2-[4-(4-ethylphenyl)butanoyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]acetic acid;formic acid (PubChem CID 154916535) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)butanoyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]acetic acid;formic acid.
| Compound Name | 2-[4-(4-ethylphenyl)butanoyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]acetic acid;formic acid |
|---|---|
| PubChem CID | 154916535 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[4-(4-ethylphenyl)butanoyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]acetic acid;formic acid |
| SMILES | CCc1ccc(CCCC(=O)N(CC(=O)O)Cc2cnc(C)[nH]2)cc1.O=CO |
| InChI | InChI=1S/C19H25N3O3.CH2O2/c1-3-15-7-9-16(10-8-15)5-4-6-18(23)22(13-19(24)25)12-17-11-20-14(2)21-17;2-1-3/h7-11H,3-6,12-13H2,1-2H3,(H,20,21)(H,24,25);1H,(H,2,3) |
| InChIKey | DONJNUPHXKCVGZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|