C13H24Cl2N4O — CID 154916752
3-[[(5-ethyl-2-methylpyrimidin-4-yl)amino]methyl]piperidin-3-ol;dihydrochloride (PubChem CID 154916752) has the molecular formula C13H24Cl2N4O and a molecular weight of 323.27 g/mol. Its IUPAC name is 3-[[(5-ethyl-2-methylpyrimidin-4-yl)amino]methyl]piperidin-3-ol;dihydrochloride.
| Compound Name | 3-[[(5-ethyl-2-methylpyrimidin-4-yl)amino]methyl]piperidin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 154916752 |
| Molecular Formula | C13H24Cl2N4O |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[[(5-ethyl-2-methylpyrimidin-4-yl)amino]methyl]piperidin-3-ol;dihydrochloride |
| SMILES | CCc1cnc(C)nc1NCC1(O)CCCNC1.Cl.Cl |
| InChI | InChI=1S/C13H22N4O.2ClH/c1-3-11-7-15-10(2)17-12(11)16-9-13(18)5-4-6-14-8-13;;/h7,14,18H,3-6,8-9H2,1-2H3,(H,15,16,17);2*1H |
| InChIKey | CJZOANVZAHQOBV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |