C18H21N5O3 — CID 154916800
formic acid;2-[2-[(6-propan-2-ylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one (PubChem CID 154916800) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is formic acid;2-[2-[(6-propan-2-ylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one.
| Compound Name | formic acid;2-[2-[(6-propan-2-ylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 154916800 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | formic acid;2-[2-[(6-propan-2-ylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one |
| SMILES | CC(C)c1cc(NCCc2nc3ccccc3c(=O)[nH]2)ncn1.O=CO |
| InChI | InChI=1S/C17H19N5O.CH2O2/c1-11(2)14-9-16(20-10-19-14)18-8-7-15-21-13-6-4-3-5-12(13)17(23)22-15;2-1-3/h3-6,9-11H,7-8H2,1-2H3,(H,18,19,20)(H,21,22,23);1H,(H,2,3) |
| InChIKey | JBXLNWZNXPWSDK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|