C18H21N5O — CID 137314025
2-[2-[(2-methyl-5-propylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one (PubChem CID 137314025) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[2-[(2-methyl-5-propylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[2-[(2-methyl-5-propylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137314025 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[2-[(2-methyl-5-propylpyrimidin-4-yl)amino]ethyl]-3H-quinazolin-4-one |
| SMILES | CCCc1cnc(C)nc1NCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H21N5O/c1-3-6-13-11-20-12(2)21-17(13)19-10-9-16-22-15-8-5-4-7-14(15)18(24)23-16/h4-5,7-8,11H,3,6,9-10H2,1-2H3,(H,19,20,21)(H,22,23,24) |
| InChIKey | CXLUEVFOYRWDGM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |