C17H19ClN4O4 — CID 154916931
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-amine;formic acid (PubChem CID 154916931) has the molecular formula C17H19ClN4O4 and a molecular weight of 378.82 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-amine;formic acid.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-amine;formic acid |
|---|---|
| PubChem CID | 154916931 |
| Molecular Formula | C17H19ClN4O4 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-amine;formic acid |
| SMILES | CN(C)Cc1nnc(NCc2ccc(-c3ccc(Cl)cc3)o2)o1.O=CO |
| InChI | InChI=1S/C16H17ClN4O2.CH2O2/c1-21(2)10-15-19-20-16(23-15)18-9-13-7-8-14(22-13)11-3-5-12(17)6-4-11;2-1-3/h3-8H,9-10H2,1-2H3,(H,18,20);1H,(H,2,3) |
| InChIKey | AAVRKDVGEZFPCI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|