C21H27N3O5S — CID 154916991
6-[(4aS,8aS)-4a-(hydroxymethyl)-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-1-carbonyl]-1H-pyridin-2-one;formic acid (PubChem CID 154916991) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 6-[(4aS,8aS)-4a-(hydroxymethyl)-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-1-carbonyl]-1H-pyridin-2-one;formic acid.
| Compound Name | 6-[(4aS,8aS)-4a-(hydroxymethyl)-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-1-carbonyl]-1H-pyridin-2-one;formic acid |
|---|---|
| PubChem CID | 154916991 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 6-[(4aS,8aS)-4a-(hydroxymethyl)-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-1-carbonyl]-1H-pyridin-2-one;formic acid |
| SMILES | O=C(c1cccc(=O)[nH]1)N1CCC[C@]2(CO)CCN(Cc3ccsc3)C[C@@H]12.O=CO |
| InChI | InChI=1S/C20H25N3O3S.CH2O2/c24-14-20-6-2-8-23(19(26)16-3-1-4-18(25)21-16)17(20)12-22(9-7-20)11-15-5-10-27-13-15;2-1-3/h1,3-5,10,13,17,24H,2,6-9,11-12,14H2,(H,21,25);1H,(H,2,3)/t17-,20-;/m1./s1 |
| InChIKey | OTXLQXXGSMITEH-OGPPPPIKSA-N |
| XLogP | 1.63 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|