C20H24N2OS — CID 97381124
1-[(3aR,7aS)-3a-phenyl-6-(thiophen-3-ylmethyl)-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-1-yl]ethanone (PubChem CID 97381124) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-[(3aR,7aS)-3a-phenyl-6-(thiophen-3-ylmethyl)-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(3aR,7aS)-3a-phenyl-6-(thiophen-3-ylmethyl)-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 97381124 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(3aR,7aS)-3a-phenyl-6-(thiophen-3-ylmethyl)-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@@]2(c3ccccc3)CCN(Cc3ccsc3)C[C@@H]12 |
| InChI | InChI=1S/C20H24N2OS/c1-16(23)22-11-9-20(18-5-3-2-4-6-18)8-10-21(14-19(20)22)13-17-7-12-24-15-17/h2-7,12,15,19H,8-11,13-14H2,1H3/t19-,20-/m1/s1 |
| InChIKey | PFZHTKMXLGYDMR-WOJBJXKFSA-N |
| XLogP | 3.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |