C18H27N3O4 — CID 154917007
formic acid;2-[(2-methyl-1H-imidazol-5-yl)methyl-[(2-propoxyphenyl)methyl]amino]ethanol (PubChem CID 154917007) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is formic acid;2-[(2-methyl-1H-imidazol-5-yl)methyl-[(2-propoxyphenyl)methyl]amino]ethanol.
| Compound Name | formic acid;2-[(2-methyl-1H-imidazol-5-yl)methyl-[(2-propoxyphenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 154917007 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | formic acid;2-[(2-methyl-1H-imidazol-5-yl)methyl-[(2-propoxyphenyl)methyl]amino]ethanol |
| SMILES | CCCOc1ccccc1CN(CCO)Cc1cnc(C)[nH]1.O=CO |
| InChI | InChI=1S/C17H25N3O2.CH2O2/c1-3-10-22-17-7-5-4-6-15(17)12-20(8-9-21)13-16-11-18-14(2)19-16;2-1-3/h4-7,11,21H,3,8-10,12-13H2,1-2H3,(H,18,19);1H,(H,2,3) |
| InChIKey | LNGLFZPBQSWSCI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|