C24H30Cl2N4 — CID 154917407
3a-(2-phenylethyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 154917407) has the molecular formula C24H30Cl2N4 and a molecular weight of 445.44 g/mol. Its IUPAC name is 3a-(2-phenylethyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | 3a-(2-phenylethyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 154917407 |
| Molecular Formula | C24H30Cl2N4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3a-(2-phenylethyl)-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CCC23CNCC2CN(Cc2cn[nH]c2-c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C24H28N4.2ClH/c1-3-7-19(8-4-1)11-12-24-17-25-14-22(24)16-28(18-24)15-21-13-26-27-23(21)20-9-5-2-6-10-20;;/h1-10,13,22,25H,11-12,14-18H2,(H,26,27);2*1H |
| InChIKey | FJICCJWIYYKEMX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |