C17H22F4N2O3 — CID 154917985
2-(4-fluorophenyl)-1-[4-(3,3,3-trifluoropropyl)-1,4-diazepan-1-yl]ethanone;formic acid (PubChem CID 154917985) has the molecular formula C17H22F4N2O3 and a molecular weight of 378.37 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[4-(3,3,3-trifluoropropyl)-1,4-diazepan-1-yl]ethanone;formic acid.
| Compound Name | 2-(4-fluorophenyl)-1-[4-(3,3,3-trifluoropropyl)-1,4-diazepan-1-yl]ethanone;formic acid |
|---|---|
| PubChem CID | 154917985 |
| Molecular Formula | C17H22F4N2O3 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[4-(3,3,3-trifluoropropyl)-1,4-diazepan-1-yl]ethanone;formic acid |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCCN(CCC(F)(F)F)CC1.O=CO |
| InChI | InChI=1S/C16H20F4N2O.CH2O2/c17-14-4-2-13(3-5-14)12-15(23)22-8-1-7-21(10-11-22)9-6-16(18,19)20;2-1-3/h2-5H,1,6-12H2;1H,(H,2,3) |
| InChIKey | AMPIMTXMJWGEAI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|