C18H26ClN3O4S2 — CID 154918071
[(4aS,8aS)-7-[2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophen-3-yl]sulfonyl-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol;hydrochloride (PubChem CID 154918071) has the molecular formula C18H26ClN3O4S2 and a molecular weight of 448.01 g/mol. Its IUPAC name is [(4aS,8aS)-7-[2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophen-3-yl]sulfonyl-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol;hydrochloride.
| Compound Name | [(4aS,8aS)-7-[2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophen-3-yl]sulfonyl-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 154918071 |
| Molecular Formula | C18H26ClN3O4S2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [(4aS,8aS)-7-[2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophen-3-yl]sulfonyl-1,2,3,4,5,6,8,8a-octahydro-1,7-naphthyridin-4a-yl]methanol;hydrochloride |
| SMILES | Cc1cc(-c2cc(S(=O)(=O)N3CC[C@@]4(CO)CCCN[C@@H]4C3)c(C)s2)on1.Cl |
| InChI | InChI=1S/C18H25N3O4S2.ClH/c1-12-8-14(25-20-12)15-9-16(13(2)26-15)27(23,24)21-7-5-18(11-22)4-3-6-19-17(18)10-21;/h8-9,17,19,22H,3-7,10-11H2,1-2H3;1H/t17-,18-;/m1./s1 |
| InChIKey | ULAXLOLFGLSQTL-JAXOOIEVSA-N |
| XLogP | 2.57 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |