C16H21N5O4 — CID 154918769
formic acid;[6-[2-(1H-imidazol-5-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 154918769) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is formic acid;[6-[2-(1H-imidazol-5-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | formic acid;[6-[2-(1H-imidazol-5-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 154918769 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | formic acid;[6-[2-(1H-imidazol-5-yl)ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(NCCc2cnc[nH]2)nc1)N1CCOCC1.O=CO |
| InChI | InChI=1S/C15H19N5O2.CH2O2/c21-15(20-5-7-22-8-6-20)12-1-2-14(18-9-12)17-4-3-13-10-16-11-19-13;2-1-3/h1-2,9-11H,3-8H2,(H,16,19)(H,17,18);1H,(H,2,3) |
| InChIKey | WPACHAHACMMVKA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|