C16H26N8O5 — CID 154919231
formic acid;1-[4-[2-(1-methylimidazol-2-yl)ethyl]-1,4-diazepan-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 154919231) has the molecular formula C16H26N8O5 and a molecular weight of 410.44 g/mol. Its IUPAC name is formic acid;1-[4-[2-(1-methylimidazol-2-yl)ethyl]-1,4-diazepan-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | formic acid;1-[4-[2-(1-methylimidazol-2-yl)ethyl]-1,4-diazepan-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 154919231 |
| Molecular Formula | C16H26N8O5 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | formic acid;1-[4-[2-(1-methylimidazol-2-yl)ethyl]-1,4-diazepan-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | Cn1ccnc1CCN1CCCN(C(=O)Cn2cnnn2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C14H22N8O.2CH2O2/c1-19-8-4-15-13(19)3-7-20-5-2-6-21(10-9-20)14(23)11-22-12-16-17-18-22;2*2-1-3/h4,8,12H,2-3,5-7,9-11H2,1H3;2*1H,(H,2,3) |
| InChIKey | JQVCFLDNFGKWHM-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|