C12H11F4N7O — CID 133371195
1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 133371195) has the molecular formula C12H11F4N7O and a molecular weight of 345.26 g/mol. Its IUPAC name is 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 133371195 |
| Molecular Formula | C12H11F4N7O |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnnn1)N1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C12H11F4N7O/c13-8-10(9(14)12(16)18-11(8)15)22-3-1-21(2-4-22)7(24)5-23-6-17-19-20-23/h6H,1-5H2 |
| InChIKey | PWOZWXCPLUIIGR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|