C19H21N5O2S — CID 154919246
N,N-dimethyl-1-[5-[1-(2-methyl-3H-benzimidazol-5-yl)imidazol-2-yl]thiophen-3-yl]methanamine;formic acid (PubChem CID 154919246) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N,N-dimethyl-1-[5-[1-(2-methyl-3H-benzimidazol-5-yl)imidazol-2-yl]thiophen-3-yl]methanamine;formic acid.
| Compound Name | N,N-dimethyl-1-[5-[1-(2-methyl-3H-benzimidazol-5-yl)imidazol-2-yl]thiophen-3-yl]methanamine;formic acid |
|---|---|
| PubChem CID | 154919246 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N,N-dimethyl-1-[5-[1-(2-methyl-3H-benzimidazol-5-yl)imidazol-2-yl]thiophen-3-yl]methanamine;formic acid |
| SMILES | Cc1nc2ccc(-n3ccnc3-c3cc(CN(C)C)cs3)cc2[nH]1.O=CO |
| InChI | InChI=1S/C18H19N5S.CH2O2/c1-12-20-15-5-4-14(9-16(15)21-12)23-7-6-19-18(23)17-8-13(11-24-17)10-22(2)3;2-1-3/h4-9,11H,10H2,1-3H3,(H,20,21);1H,(H,2,3) |
| InChIKey | IZFPUJUYGDERFK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|