C20H33N3O4 — CID 154919996
4-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane;formic acid (PubChem CID 154919996) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane;formic acid.
| Compound Name | 4-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane;formic acid |
|---|---|
| PubChem CID | 154919996 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 4-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane;formic acid |
| SMILES | CN1CCN(Cc2cc(C3CCCCC3)no2)CC12CCOCC2.O=CO |
| InChI | InChI=1S/C19H31N3O2.CH2O2/c1-21-9-10-22(15-19(21)7-11-23-12-8-19)14-17-13-18(20-24-17)16-5-3-2-4-6-16;2-1-3/h13,16H,2-12,14-15H2,1H3;1H,(H,2,3) |
| InChIKey | AVYFZHRHGBKAKH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|