C21H33N3O5 — CID 172909889
9-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-4-hydroxy-2-methyl-2,9-diazaspiro[5.5]undecan-1-one;formic acid (PubChem CID 172909889) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is 9-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-4-hydroxy-2-methyl-2,9-diazaspiro[5.5]undecan-1-one;formic acid.
| Compound Name | 9-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-4-hydroxy-2-methyl-2,9-diazaspiro[5.5]undecan-1-one;formic acid |
|---|---|
| PubChem CID | 172909889 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 9-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-4-hydroxy-2-methyl-2,9-diazaspiro[5.5]undecan-1-one;formic acid |
| SMILES | CN1CC(O)CC2(CCN(Cc3cc(C4CCCCC4)no3)CC2)C1=O.O=CO |
| InChI | InChI=1S/C20H31N3O3.CH2O2/c1-22-13-16(24)12-20(19(22)25)7-9-23(10-8-20)14-17-11-18(21-26-17)15-5-3-2-4-6-15;2-1-3/h11,15-16,24H,2-10,12-14H2,1H3;1H,(H,2,3) |
| InChIKey | YMLQBFSMRNEKAE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|