C16H23N3O3 — CID 154920039
(3aR,6aR)-4-[2-(N-methylanilino)ethyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;formic acid (PubChem CID 154920039) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3aR,6aR)-4-[2-(N-methylanilino)ethyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;formic acid.
| Compound Name | (3aR,6aR)-4-[2-(N-methylanilino)ethyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;formic acid |
|---|---|
| PubChem CID | 154920039 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3aR,6aR)-4-[2-(N-methylanilino)ethyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;formic acid |
| SMILES | CN(CCN1C(=O)C[C@H]2NCC[C@H]21)c1ccccc1.O=CO |
| InChI | InChI=1S/C15H21N3O.CH2O2/c1-17(12-5-3-2-4-6-12)9-10-18-14-7-8-16-13(14)11-15(18)19;2-1-3/h2-6,13-14,16H,7-11H2,1H3;1H,(H,2,3)/t13-,14-;/m1./s1 |
| InChIKey | RFVRDWNEWYTUFH-DTPOWOMPSA-N |
| XLogP | 0.79 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|