C14H18N2O — CID 155875079
(3aS,6aS)-4-[(2-methylphenyl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one (PubChem CID 155875079) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (3aS,6aS)-4-[(2-methylphenyl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aS)-4-[(2-methylphenyl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 155875079 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (3aS,6aS)-4-[(2-methylphenyl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
| SMILES | Cc1ccccc1CN1C(=O)C[C@@H]2NCC[C@@H]21 |
| InChI | InChI=1S/C14H18N2O/c1-10-4-2-3-5-11(10)9-16-13-6-7-15-12(13)8-14(16)17/h2-5,12-13,15H,6-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | BZPPQOWYXNGDMY-STQMWFEESA-N |
| XLogP | 1.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |