C14H17ClN4O2S — CID 154922223
(3aR,6aR)-4-[[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride (PubChem CID 154922223) has the molecular formula C14H17ClN4O2S and a molecular weight of 340.84 g/mol. Its IUPAC name is (3aR,6aR)-4-[[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride.
| Compound Name | (3aR,6aR)-4-[[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride |
|---|---|
| PubChem CID | 154922223 |
| Molecular Formula | C14H17ClN4O2S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (3aR,6aR)-4-[[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride |
| SMILES | Cl.O=C1C[C@H]2NCC[C@H]2N1Cc1nc(Cc2cccs2)no1 |
| InChI | InChI=1S/C14H16N4O2S.ClH/c19-14-7-10-11(3-4-15-10)18(14)8-13-16-12(17-20-13)6-9-2-1-5-21-9;/h1-2,5,10-11,15H,3-4,6-8H2;1H/t10-,11-;/m1./s1 |
| InChIKey | DMGIMGOKOOYBAZ-NDXYWBNTSA-N |
| XLogP | 1.61 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |