C17H21ClN4O2 — CID 154922342
(3aR,6aR)-4-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride (PubChem CID 154922342) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is (3aR,6aR)-4-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride.
| Compound Name | (3aR,6aR)-4-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride |
|---|---|
| PubChem CID | 154922342 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (3aR,6aR)-4-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one;hydrochloride |
| SMILES | COc1ccc(-c2[nH]ncc2CN2C(=O)C[C@H]3NCC[C@H]32)cc1.Cl |
| InChI | InChI=1S/C17H20N4O2.ClH/c1-23-13-4-2-11(3-5-13)17-12(9-19-20-17)10-21-15-6-7-18-14(15)8-16(21)22;/h2-5,9,14-15,18H,6-8,10H2,1H3,(H,19,20);1H/t14-,15-;/m1./s1 |
| InChIKey | BJMCWDMRBXYGPE-CTHHTMFSSA-N |
| XLogP | 1.97 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |