C18H22N6O — CID 97206014
(3S)-3-[1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]triazol-4-yl]piperidine (PubChem CID 97206014) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is (3S)-3-[1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]triazol-4-yl]piperidine.
| Compound Name | (3S)-3-[1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]triazol-4-yl]piperidine |
|---|---|
| PubChem CID | 97206014 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3S)-3-[1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]triazol-4-yl]piperidine |
| SMILES | COc1ccc(-c2[nH]ncc2Cn2cc([C@H]3CCCNC3)nn2)cc1 |
| InChI | InChI=1S/C18H22N6O/c1-25-16-6-4-13(5-7-16)18-15(10-20-22-18)11-24-12-17(21-23-24)14-3-2-8-19-9-14/h4-7,10,12,14,19H,2-3,8-9,11H2,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | ZUYNPGGLAMNTEA-AWEZNQCLSA-N |
| XLogP | 2.19 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |