C20H25N5O — CID 77083372
1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine (PubChem CID 77083372) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine.
| Compound Name | 1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 77083372 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine |
| SMILES | COc1ccc(-c2[nH]ncc2CN2CCCC(c3nccn3C)C2)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-24-11-9-21-20(24)16-4-3-10-25(13-16)14-17-12-22-23-19(17)15-5-7-18(26-2)8-6-15/h5-9,11-12,16H,3-4,10,13-14H2,1-2H3,(H,22,23) |
| InChIKey | NWXOJXXIBHPMQG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |