C20H25N5O — CID 77088238
1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine (PubChem CID 77088238) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine.
| Compound Name | 1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 77088238 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-[[1-(4-methoxyphenyl)imidazol-2-yl]methyl]-3-(1-methylimidazol-2-yl)piperidine |
| SMILES | COc1ccc(-n2ccnc2CN2CCCC(c3nccn3C)C2)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-23-12-9-22-20(23)16-4-3-11-24(14-16)15-19-21-10-13-25(19)17-5-7-18(26-2)8-6-17/h5-10,12-13,16H,3-4,11,14-15H2,1-2H3 |
| InChIKey | GFHAFDAQDWFPDK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |