C29H38ClN5O6 — CID 154920234
(6S,9S,12S)-9-benzyl-6,12-dimethylspiro[2,17-dioxa-5,8,11,14-tetrazabicyclo[16.2.2]docosa-1(20),18,21-triene-3,4'-piperidine]-4,7,10,13-tetrone;hydrochloride (PubChem CID 154920234) has the molecular formula C29H38ClN5O6 and a molecular weight of 588.11 g/mol. Its IUPAC name is (6S,9S,12S)-9-benzyl-6,12-dimethylspiro[2,17-dioxa-5,8,11,14-tetrazabicyclo[16.2.2]docosa-1(20),18,21-triene-3,4'-piperidine]-4,7,10,13-tetrone;hydrochloride.
| Compound Name | (6S,9S,12S)-9-benzyl-6,12-dimethylspiro[2,17-dioxa-5,8,11,14-tetrazabicyclo[16.2.2]docosa-1(20),18,21-triene-3,4'-piperidine]-4,7,10,13-tetrone;hydrochloride |
|---|---|
| PubChem CID | 154920234 |
| Molecular Formula | C29H38ClN5O6 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | (6S,9S,12S)-9-benzyl-6,12-dimethylspiro[2,17-dioxa-5,8,11,14-tetrazabicyclo[16.2.2]docosa-1(20),18,21-triene-3,4'-piperidine]-4,7,10,13-tetrone;hydrochloride |
| SMILES | C[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](C)NC(=O)C2(CCNCC2)Oc2ccc(cc2)OCCNC1=O.Cl |
| InChI | InChI=1S/C29H37N5O6.ClH/c1-19-25(35)31-16-17-39-22-8-10-23(11-9-22)40-29(12-14-30-15-13-29)28(38)33-20(2)26(36)34-24(27(37)32-19)18-21-6-4-3-5-7-21;/h3-11,19-20,24,30H,12-18H2,1-2H3,(H,31,35)(H,32,37)(H,33,38)(H,34,36);1H/t19-,20-,24-;/m0./s1 |
| InChIKey | NOBQSBQRKSCFQT-GWCCHDLDSA-N |
| XLogP | 0.85 |
| TPSA | 146.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|