C19H28N2O5 — CID 154920359
5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpiperidin-2-one;formic acid (PubChem CID 154920359) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpiperidin-2-one;formic acid.
| Compound Name | 5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpiperidin-2-one;formic acid |
|---|---|
| PubChem CID | 154920359 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1-methylpiperidin-2-one;formic acid |
| SMILES | COc1cc2c(cc1OC)CN(CC1CCC(=O)N(C)C1)CC2.O=CO |
| InChI | InChI=1S/C18H26N2O3.CH2O2/c1-19-10-13(4-5-18(19)21)11-20-7-6-14-8-16(22-2)17(23-3)9-15(14)12-20;2-1-3/h8-9,13H,4-7,10-12H2,1-3H3;1H,(H,2,3) |
| InChIKey | BLBPHFQCCYQDKL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|