C23H35N5O7S — CID 154921240
(3S,3aS,6aR)-5-[[4-methoxy-3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;acetic acid (PubChem CID 154921240) has the molecular formula C23H35N5O7S and a molecular weight of 525.63 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-[[4-methoxy-3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;acetic acid.
| Compound Name | (3S,3aS,6aR)-5-[[4-methoxy-3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;acetic acid |
|---|---|
| PubChem CID | 154921240 |
| Molecular Formula | C23H35N5O7S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | (3S,3aS,6aR)-5-[[4-methoxy-3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;acetic acid |
| SMILES | CC(=O)O.CC(=O)O.COc1ccc(CN2C[C@H]3[C@H](N(C)C)CS(=O)(=O)[C@H]3C2)cc1Cn1cncn1 |
| InChI | InChI=1S/C19H27N5O3S.2C2H4O2/c1-22(2)17-11-28(25,26)19-10-23(9-16(17)19)7-14-4-5-18(27-3)15(6-14)8-24-13-20-12-21-24;2*1-2(3)4/h4-6,12-13,16-17,19H,7-11H2,1-3H3;2*1H3,(H,3,4)/t16-,17+,19-;;/m0../s1 |
| InChIKey | DREWQIHVQXIFCB-VLLIFGQUSA-N |
| XLogP | 0.68 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |