C21H32N2O7S — CID 155940167
1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-3-(3,4-dimethoxyphenyl)propan-1-one;acetic acid (PubChem CID 155940167) has the molecular formula C21H32N2O7S and a molecular weight of 456.56 g/mol. Its IUPAC name is 1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-3-(3,4-dimethoxyphenyl)propan-1-one;acetic acid.
| Compound Name | 1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-3-(3,4-dimethoxyphenyl)propan-1-one;acetic acid |
|---|---|
| PubChem CID | 155940167 |
| Molecular Formula | C21H32N2O7S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-3-(3,4-dimethoxyphenyl)propan-1-one;acetic acid |
| SMILES | CC(=O)O.COc1ccc(CCC(=O)N2C[C@H]3[C@H](N(C)C)CS(=O)(=O)[C@H]3C2)cc1OC |
| InChI | InChI=1S/C19H28N2O5S.C2H4O2/c1-20(2)15-12-27(23,24)18-11-21(10-14(15)18)19(22)8-6-13-5-7-16(25-3)17(9-13)26-4;1-2(3)4/h5,7,9,14-15,18H,6,8,10-12H2,1-4H3;1H3,(H,3,4)/t14-,15+,18-;/m0./s1 |
| InChIKey | QRBAANJZIMZEAB-KZKRVDMVSA-N |
| XLogP | 0.91 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |