C19H25Cl2N7O — CID 154921383
2-[5-[(1S)-1-aminoethyl]-3-phenyl-1,2,4-triazol-1-yl]-1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone;dihydrochloride (PubChem CID 154921383) has the molecular formula C19H25Cl2N7O and a molecular weight of 438.36 g/mol. Its IUPAC name is 2-[5-[(1S)-1-aminoethyl]-3-phenyl-1,2,4-triazol-1-yl]-1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone;dihydrochloride.
| Compound Name | 2-[5-[(1S)-1-aminoethyl]-3-phenyl-1,2,4-triazol-1-yl]-1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 154921383 |
| Molecular Formula | C19H25Cl2N7O |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[5-[(1S)-1-aminoethyl]-3-phenyl-1,2,4-triazol-1-yl]-1-(2-methyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone;dihydrochloride |
| SMILES | Cc1nc2c([nH]1)CN(C(=O)Cn1nc(-c3ccccc3)nc1[C@H](C)N)CC2.Cl.Cl |
| InChI | InChI=1S/C19H23N7O.2ClH/c1-12(20)19-23-18(14-6-4-3-5-7-14)24-26(19)11-17(27)25-9-8-15-16(10-25)22-13(2)21-15;;/h3-7,12H,8-11,20H2,1-2H3,(H,21,22);2*1H/t12-;;/m0../s1 |
| InChIKey | XIGAZYJQMILYTE-LTCKWSDVSA-N |
| XLogP | 2.42 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |