C17H21N3O2 — CID 72863884
butyl 2-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 72863884) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is butyl 2-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate.
| Compound Name | butyl 2-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 72863884 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | butyl 2-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | CCCCOC(=O)N1CCc2nc(-c3ccccc3)[nH]c2C1 |
| InChI | InChI=1S/C17H21N3O2/c1-2-3-11-22-17(21)20-10-9-14-15(12-20)19-16(18-14)13-7-5-4-6-8-13/h4-8H,2-3,9-12H2,1H3,(H,18,19) |
| InChIKey | GDTDCZBHFFNHLM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|