C22H24N4O2 — CID 91837733
4-[5-(3-phenoxypropyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]benzamide (PubChem CID 91837733) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[5-(3-phenoxypropyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]benzamide.
| Compound Name | 4-[5-(3-phenoxypropyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 91837733 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[5-(3-phenoxypropyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2nc3c([nH]2)CN(CCCOc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C22H24N4O2/c23-21(27)16-7-9-17(10-8-16)22-24-19-11-13-26(15-20(19)25-22)12-4-14-28-18-5-2-1-3-6-18/h1-3,5-10H,4,11-15H2,(H2,23,27)(H,24,25) |
| InChIKey | XHZBDNHOPTYRTO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|